Conditional Probability

Understanding how probabilities change when new information is available, including the Multiplication Rule, Independence, the Theorem of Total Probability, and Bayes' Theorem.
In engineering, we rarely evaluate risks in isolation. Our assessment of a structure's failure probability changes if we already know that a defect was present during construction. This updating of probabilities based on prior knowledge is called conditional probability.

The Concept of Conditional Probability

Adjusting the probability of an event given that another event has already occurred.

Conditional Probability, P(BA)P(B|A)

The probability that event BB occurs, given that event AA has already occurred. It effectively reduces the sample space from SS to just the outcomes in AA.
P(BA)=P(AB)P(A)for P(A)>0 P(B|A) = \frac{P(A \cap B)}{P(A)} \quad \text{for } P(A) > 0

The Multiplication Rule (General)

Used to find the probability that two events AA and BB occur simultaneously (ABA \cap B). It is a direct rearrangement of the conditional probability formula.
P(AB)=P(A)P(BA) P(A \cap B) = P(A) \cdot P(B|A)
Or, symmetrically:
P(AB)=P(B)P(AB) P(A \cap B) = P(B) \cdot P(A|B)

Independent Events

When the occurrence of one event has absolutely no effect on the probability of another.
In structural engineering, deciding whether the failure of one column affects the failure probability of an adjacent column is a critical assessment of independence.

Independence

Two events AA and BB are independent if and only if the knowledge that AA occurred does not change the probability of BB occurring. Mathematically, this is expressed as:
P(BA)=P(B)andP(AB)=P(A) P(B|A) = P(B) \quad \text{and} \quad P(A|B) = P(A)
Substituting this into the general multiplication rule yields the Special Multiplication Rule for Independent Events:
P(AB)=P(A)P(B) P(A \cap B) = P(A) \cdot P(B)

Independence of Multiple Events

For three events A,B,CA, B, C to be mutually independent, they must be pairwise independent (P(AB)=P(A)P(B)P(A \cap B) = P(A)P(B), etc.), AND their joint probability must equal the product of their individual probabilities: P(ABC)=P(A)P(B)P(C)P(A \cap B \cap C) = P(A)P(B)P(C).

The Theorem of Total Probability and Bayes' Theorem

Advanced tools for calculating probabilities when an event can occur through multiple, distinct pathways.

The Theorem of Total Probability

If a sample space SS is partitioned into nn mutually exclusive and collectively exhaustive events (B1,B2,,BnB_1, B_2, \dots, B_n), then the probability of any event AA occurring is the sum of the probabilities of AA occurring in conjunction with each partition.
P(A)=i=1nP(BiA)=i=1nP(Bi)P(ABi) P(A) = \sum_{i=1}^{n} P(B_i \cap A) = \sum_{i=1}^{n} P(B_i) \cdot P(A|B_i)
Engineering Application: If a concrete batch AA can fail due to poor mixing (B1B_1), improper curing (B2B_2), or bad aggregates (B3B_3), the total probability of failure P(A)P(A) is the sum of the probabilities of failure given each specific cause, weighted by how frequently each cause occurs.

Bayes' Theorem

A powerful mathematical formula used to update the probabilities of hypotheses when given new evidence. It essentially reverses the conditional probability. If we know the probability of an effect given a cause (P(ABi)P(A|B_i)), Bayes' Theorem lets us find the probability of a specific cause given that the effect occurred (P(BiA)P(B_i|A)).
P(BiA)=P(Bi)P(ABi)j=1nP(Bj)P(ABj) P(B_i|A) = \frac{P(B_i) \cdot P(A|B_i)}{\sum_{j=1}^{n} P(B_j) \cdot P(A|B_j)}
  • Prior Probability (P(Bi)P(B_i)): Our initial estimate of the probability of cause BiB_i before observing the evidence AA.
  • Likelihood (P(ABi)P(A|B_i)): The probability of observing evidence AA if cause BiB_i is true.
  • Posterior Probability (P(BiA)P(B_i|A)): The updated probability of cause BiB_i after observing the evidence AA.

Bayes' Theorem Explorer

2.0%

Initial probability of a defect.

95.0%

Probability test is positive when defect is present.

10.0%

Probability test is positive when NO defect is present.

Posterior Probability

16.2%

$P(D|T)$ - Probability it is actually defective given a positive test.

Total Positives $P(T)$11.7%
True Positives $P(T|D) \times P(D)$1.90%
False Positives $P(T|G) \times P(G)$9.80%
Key Takeaways
  • Conditional Probability (P(BA)P(B|A)): The probability of BB given that AA has occurred; shrinks the sample space to AA.
  • Multiplication Rule: Used for "A AND B" scenarios (ABA \cap B).
  • Independence: If AA and BB are independent, P(AB)=P(A)P(B)P(A \cap B) = P(A) \cdot P(B).
  • Theorem of Total Probability: Useful for finding the total probability of an event that can occur across multiple mutually exclusive pathways.
  • Bayes' Theorem: Allows engineers to "work backward" from an observed effect (e.g., structural failure) to determine the most likely cause, updating prior beliefs with new evidence.